Probe Summary
Names: VELIPARIB, 78P, ABT-888, ABT-888 (Veliparib), ABT-888, veliparib, ABT888/Veliparib, COVC-2821779385, Chemical probe: ABT-888, PARP-1 INHIBITOR ABT-888, Veliparib, canSAR1081646, 912444-00-9; ABT-888; ABT 888; ABT888; UNII-01O4K0631N
| Targets | Biochemical/Biophysical Potency | Cellular Potency |
|---|---|---|
| PARP1 |
|
|
| PARP2 |
|
|
Selectivity
Potency: Ki - SIRT2 >5,000 nM
Potency Cellular
In Vitro
Mode of Action: Inhibitor
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1021/acs.jmedchem.6b00990
Mode of Action: Inhibitor
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1021/acs.jmedchem.6b00990
In Vivo Validations
DOI Reference: 10.1158/1078-0432.CCR-06-3039
Chemical Information
| Molecular Formula | C13H16N4O |
| SMILEs | C[C@]1(c2nc3cccc(C(N)=O)c3[nH]2)CCCN1 |
| InChI | InChI=1S/C13H16N4O/c1-13(6-3-7-15-13)12-16-9-5-2-4-8(11(14)18)10(9)17-12/h2,4-5,15H,3,6-7H2,1H3,(H2,14,18)(H,16,17)/t13-/m1/s1 |
| Molecular weight | 244.13 Da |
| AlogP | 1.2604 |
| HBond acceptors | 5 |
| HBond donors | 4 |
| Atoms | 34 |
References
Cross References
GDSCVendors
Note: This is not an exhaustive list and does not indicate endorsement by the portal.