Probe Summary
| Targets | Biochemical/Biophysical Potency | Cellular Potency |
|---|---|---|
| MAPK8 |
|
|
| MAPK9 |
| |
| MAPK10 |
|
Selectivity
Potency Cellular
In Vitro
Mode of Action: Inhibitor
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1016/j.bmcl.2011.12.027
Mode of Action: Inhibitor
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1016/j.bmcl.2011.12.027
Mode of Action: Inhibitor
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1016/j.bmcl.2011.12.027
In Vivo Validations
DOI Reference: 10.1016/j.bmcl.2011.12.027
DOI Reference: 10.1016/j.bmcl.2011.12.027
DOI Reference: 10.1016/j.bmcl.2011.12.027
DOI Reference: 10.1016/j.bmcl.2011.12.027
DOI Reference: 10.1016/j.bmcl.2011.12.027
DOI Reference: 10.1016/j.bmcl.2011.12.027
Chemical Information
| Molecular Formula | C21H23F3N6O2 |
| SMILEs | O[C@H]1CC[C@H](Nc2ncc3nc(Nc4c(F)cc(F)cc4F)n([C@H]4CCOC4)c3n2)CC1 |
| InChI | InChI=1S/C21H23F3N6O2/c22-11-7-15(23)18(16(24)8-11)28-21-27-17-9-25-20(26-12-1-3-14(31)4-2-12)29-19(17)30(21)13-5-6-32-10-13/h7-9,12-14,31H,1-6,10H2,(H,27,28)(H,25,26,29)/t12-,13-,14-/m0/s1 |
| Molecular weight | 448.18 Da |
| AlogP | 3.6640000000000024 |
| HBond acceptors | 8 |
| HBond donors | 3 |
| Atoms | 55 |