PFI-7 |
PFI-7 : Inhibitor of GID4
Probe Summary
| Targets | Biochemical/Biophysical Potency | Cellular Potency |
|---|---|---|
| GID4 |
|
|
up to 10 uM
Selectivity
Potency Cellular
In Vitro
GID4
Mode of Action: Inhibitor
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1038/s41589-024-01618-0
Negative Control Compounds
Chemical Information
| Molecular Formula | C24H27N5O |
| SMILEs | O=C(CNCc1cc2ccccc2[nH]1)N[C@H]1CC[C@@H](c2nc3ccccc3[nH]2)CC1 |
| InChI | InChI=1S/C24H27N5O/c30-23(15-25-14-19-13-17-5-1-2-6-20(17)26-19)27-18-11-9-16(10-12-18)24-28-21-7-3-4-8-22(21)29-24/h1-8,13,16,18,25-26H,9-12,14-15H2,(H,27,30)(H,28,29)/t16-,18+ |
| Molecular weight | 401.22 Da |
| AlogP | 3.9764000000000026 |
| HBond acceptors | 6 |
| HBond donors | 4 |
| Atoms | 57 |
