Probe Summary
| Targets | Biochemical/Biophysical Potency | Cellular Potency |
|---|---|---|
| PARP1 |
|
|
Selectivity
Potency: KD - PARP2: 1.39 uM, PARP3 (ARTD3): 0.69 uM, TNKS1 (PARP5a): >10 uM
Potency: IC50 - SIRT1: >10 uM
Potency Cellular
In Vitro
Mode of Action: Inhibitor
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1021/acs.jmedchem.5b00680
In Vivo Validations
DOI Reference: 10.1021/acs.jmedchem.5b00680
DOI Reference: 10.1021/acs.jmedchem.5b00680
DOI Reference: 10.1021/acs.jmedchem.5b00680
DOI Reference: 10.1021/acs.jmedchem.5b00680
Chemical Information
| Molecular Formula | C20H24F3N3O2 |
| SMILEs | NC(=O)c1cc(F)cc2c1C(=O)N(C1CCN(C3CCC(F)(F)CC3)CC1)C2 |
| InChI | InChI=1S/C20H24F3N3O2/c21-13-9-12-11-26(19(28)17(12)16(10-13)18(24)27)15-3-7-25(8-4-15)14-1-5-20(22,23)6-2-14/h9-10,14-15H,1-8,11H2,(H2,24,27) |
| Molecular weight | 395.18 Da |
| AlogP | 2.9227000000000016 |
| HBond acceptors | 5 |
| HBond donors | 2 |
| Atoms | 52 |
References
Publications
Vendors
Note: This is not an exhaustive list and does not indicate endorsement by the Portal.