Probe Summary
Names: REPAGLINIDE, A10BX02, AG-EE 623 ZW, AG-EE-623-ZW, AG-EE-623ZW, AGEE-623ZW, BJX, COVC-3357844292, Enyglid, NSC-759893, Novonorm, Prandin, Repaglinide, canSAR494113
| Targets | Biochemical/Biophysical Potency | Cellular Potency |
|---|---|---|
| ABCC8 |
|
|
| KCNJ11 |
|
|
Selectivity
Potency: IC50 - SLC22A1: 9,200 nM
Potency Cellular
In Vitro
Mode of Action: Inhibitor
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.2337/diabetes.51.9.2789
Mode of Action: Inhibitor
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.2337/diabetes.51.9.2789
In Vivo Validations
DOI Reference: 10.1016/j.bmcl.2004.07.059
Orthogonal Probes def
Chemical Information
| Molecular Formula | C27H36N2O4 |
| SMILEs | CCOc1cc(CC(=O)N[C@@H](CC(C)C)c2ccccc2N2CCCCC2)ccc1C(=O)O |
| InChI | InChI=1S/C27H36N2O4/c1-4-33-25-17-20(12-13-22(25)27(31)32)18-26(30)28-23(16-19(2)3)21-10-6-7-11-24(21)29-14-8-5-9-15-29/h6-7,10-13,17,19,23H,4-5,8-9,14-16,18H2,1-3H3,(H,28,30)(H,31,32)/t23-/m0/s1 |
| Molecular weight | 452.27 Da |
| AlogP | 0.0 |
| HBond acceptors | 6 |
| HBond donors | 2 |
| Atoms | 69 |
References
Publications
Vendors
Note: This is not an exhaustive list and does not indicate endorsement by the portal.