Probe Summary
| Targets | Biochemical/Biophysical Potency | Cellular Potency |
|---|---|---|
| PAK1 |
|
|
| PAK2 |
|
|
| PAK3 |
|
|
Selectivity
Potency Cellular
In Vitro
Mode of Action: ATP competitive
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1021/acsmedchemlett.5b00398
Mode of Action: ATP competitive
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1021/acsmedchemlett.5b00398
Mode of Action: ATP competitive
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1021/acsmedchemlett.5b00398
In Vivo Validations
DOI Reference: 10.1021/acsmedchemlett.5b00398
DOI Reference: 10.1021/acsmedchemlett.5b00398
Negative Control Compounds
Chemical Information
| Molecular Formula | C25H25ClN6O3 |
| SMILEs | CNc1ncc2cc(-c3ccc(-c4cccc(C)n4)cc3Cl)c(=O)n(C[C@H]3OC[C@H](N)CO3)c2n1 |
| InChI | InChI=1S/C25H25ClN6O3/c1-14-4-3-5-21(30-14)15-6-7-18(20(26)9-15)19-8-16-10-29-25(28-2)31-23(16)32(24(19)33)11-22-34-12-17(27)13-35-22/h3-10,17,22H,11-13,27H2,1-2H3,(H,28,29,31)/t17-,22- |
| Molecular weight | 492.17 Da |
| AlogP | 3.22422 |
| HBond acceptors | 9 |
| HBond donors | 3 |
| Atoms | 60 |
Vendors
Note: This is not an exhaustive list and does not indicate endorsement by the Portal.